About methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate
methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate (PubChem CID 66285952) has the molecular formula C9H9N5O2
and a molecular weight of 219.20 g/mol. Its IUPAC name is methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate.
Analyze methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate?
The IUPAC name of methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate (CID 66285952) is methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate?
The canonical SMILES for methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate is COC(=O)c1nc(C)cc(-n2cncn2)n1.
What is the InChIKey of methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate?
The InChIKey is XFBMOLMXSIJEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O2/c1-6-3-7(14-5-10-4-11-14)13-8(12-6)9(15)16-2/h3-5H,1-2H3.
What are the key properties of methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate?
methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate has a molecular weight of 219.20 g/mol, XLogP of 0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-6-(1,2,4-triazol-1-yl)pyrimidine-2-carboxylate is sourced from PubChem (CID 66285952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).