C10H12N6O2 — CID 66287461
methyl 4-[1-(2H-tetrazol-5-yl)ethylamino]pyridine-2-carboxylate (PubChem CID 66287461) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is methyl 4-[1-(2H-tetrazol-5-yl)ethylamino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[1-(2H-tetrazol-5-yl)ethylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66287461 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | methyl 4-[1-(2H-tetrazol-5-yl)ethylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(C)c2nn[nH]n2)ccn1 |
| InChI | InChI=1S/C10H12N6O2/c1-6(9-13-15-16-14-9)12-7-3-4-11-8(5-7)10(17)18-2/h3-6H,1-2H3,(H,11,12)(H,13,14,15,16) |
| InChIKey | AKYYFCBFFPWUQJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |