About (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate
(4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate (PubChem CID 66291413) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate.
Molecular Properties
| Compound Name | (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate |
| PubChem CID | 66291413 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate |
| SMILES | CCOc1ccc(OC(=O)CN2CC[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-2-18-12-3-5-13(6-4-12)19-14(17)10-15-8-7-11(16)9-15/h3-6,11,16H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | OEHHLIFJBOHOME-LLVKDONJSA-N |
| XLogP | 1.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate?
The IUPAC name of (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate (CID 66291413) is (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate.
What is the SMILES notation for (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate?
The canonical SMILES for (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate is CCOc1ccc(OC(=O)CN2CC[C@@H](O)C2)cc1.
What is the InChIKey of (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate?
The InChIKey is OEHHLIFJBOHOME-LLVKDONJSA-N. The full InChI is InChI=1S/C14H19NO4/c1-2-18-12-3-5-13(6-4-12)19-14(17)10-15-8-7-11(16)9-15/h3-6,11,16H,2,7-10H2,1H3/t11-/m1/s1.
What are the key properties of (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate?
(4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate has a molecular weight of 265.31 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl) 2-[(3R)-3-hydroxypyrrolidin-1-yl]acetate is sourced from PubChem (CID 66291413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).