C14H19NO5 — CID 79410220
(4-ethoxyphenyl) 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]acetate (PubChem CID 79410220) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (4-ethoxyphenyl) 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]acetate.
| Compound Name | (4-ethoxyphenyl) 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 79410220 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (4-ethoxyphenyl) 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]acetate |
| SMILES | CCOc1ccc(OC(=O)CN2C[C@@H](O)[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C14H19NO5/c1-2-19-10-3-5-11(6-4-10)20-14(18)9-15-7-12(16)13(17)8-15/h3-6,12-13,16-17H,2,7-9H2,1H3/t12-,13+ |
| InChIKey | RWAYMQDYYKVIRO-BETUJISGSA-N |
| XLogP | 0.03 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|