C14H13ClFIN2S — CID 66293770
4-chloro-2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidine (PubChem CID 66293770) has the molecular formula C14H13ClFIN2S and a molecular weight of 422.69 g/mol. Its IUPAC name is 4-chloro-2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidine.
| Compound Name | 4-chloro-2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidine |
|---|---|
| PubChem CID | 66293770 |
| Molecular Formula | C14H13ClFIN2S |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 4-chloro-2-[(2-fluorophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidine |
| SMILES | CCCc1nc(CSc2ccccc2F)nc(Cl)c1I |
| InChI | InChI=1S/C14H13ClFIN2S/c1-2-5-10-13(17)14(15)19-12(18-10)8-20-11-7-4-3-6-9(11)16/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | RRSMDZHNYWBZBI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|