C16H18BrN3O — CID 66294321
5-bromo-N-methyl-2-(oxolan-2-ylmethyl)-6-phenylpyrimidin-4-amine (PubChem CID 66294321) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 5-bromo-N-methyl-2-(oxolan-2-ylmethyl)-6-phenylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-methyl-2-(oxolan-2-ylmethyl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66294321 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-bromo-N-methyl-2-(oxolan-2-ylmethyl)-6-phenylpyrimidin-4-amine |
| SMILES | CNc1nc(CC2CCCO2)nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C16H18BrN3O/c1-18-16-14(17)15(11-6-3-2-4-7-11)19-13(20-16)10-12-8-5-9-21-12/h2-4,6-7,12H,5,8-10H2,1H3,(H,18,19,20) |
| InChIKey | IONZQZPNHPDHKC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |