C16H19N3 — CID 104846775
2-(cyclopropylmethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine (PubChem CID 104846775) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine.
| Compound Name | 2-(cyclopropylmethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104846775 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(cyclopropylmethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine |
| SMILES | CNc1nc(CC2CC2)nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C16H19N3/c1-11-15(13-6-4-3-5-7-13)18-14(10-12-8-9-12)19-16(11)17-2/h3-7,12H,8-10H2,1-2H3,(H,17,18,19) |
| InChIKey | BORHDMLYOWOFIB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |