C15H18BrN3O2 — CID 66295791
5-bromo-2-(2,3-dimethoxyphenyl)-6-ethyl-N-methylpyrimidin-4-amine (PubChem CID 66295791) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 5-bromo-2-(2,3-dimethoxyphenyl)-6-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(2,3-dimethoxyphenyl)-6-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66295791 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-bromo-2-(2,3-dimethoxyphenyl)-6-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(-c2cccc(OC)c2OC)nc(NC)c1Br |
| InChI | InChI=1S/C15H18BrN3O2/c1-5-10-12(16)15(17-2)19-14(18-10)9-7-6-8-11(20-3)13(9)21-4/h6-8H,5H2,1-4H3,(H,17,18,19) |
| InChIKey | WOVISMMDOXFXQU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |