C15H22BrN5 — CID 83084574
5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-6-ethyl-N-methylpyrimidin-4-amine (PubChem CID 83084574) has the molecular formula C15H22BrN5 and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-6-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-6-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83084574 |
| Molecular Formula | C15H22BrN5 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-6-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(-c2cn(C)nc2C(C)(C)C)nc(NC)c1Br |
| InChI | InChI=1S/C15H22BrN5/c1-7-10-11(16)14(17-5)19-13(18-10)9-8-21(6)20-12(9)15(2,3)4/h8H,7H2,1-6H3,(H,17,18,19) |
| InChIKey | ZCYUWMJYBCZJON-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |