C14H13BrIN3O2 — CID 66296489
2-(7-bromo-1,3-benzodioxol-5-yl)-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 66296489) has the molecular formula C14H13BrIN3O2 and a molecular weight of 462.09 g/mol. Its IUPAC name is 2-(7-bromo-1,3-benzodioxol-5-yl)-5-iodo-N-propylpyrimidin-4-amine.
| Compound Name | 2-(7-bromo-1,3-benzodioxol-5-yl)-5-iodo-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66296489 |
| Molecular Formula | C14H13BrIN3O2 |
| Molecular Weight | 462.09 g/mol |
| Exact Mass | 460.92 |
| IUPAC Name | 2-(7-bromo-1,3-benzodioxol-5-yl)-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(Br)c3c(c2)OCO3)ncc1I |
| InChI | InChI=1S/C14H13BrIN3O2/c1-2-3-17-14-10(16)6-18-13(19-14)8-4-9(15)12-11(5-8)20-7-21-12/h4-6H,2-3,7H2,1H3,(H,17,18,19) |
| InChIKey | NCZWVOXJVHAEPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|