C13H12BrFIN3 — CID 66423303
2-(3-bromo-5-fluorophenyl)-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 66423303) has the molecular formula C13H12BrFIN3 and a molecular weight of 436.07 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-5-iodo-N-propylpyrimidin-4-amine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-5-iodo-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66423303 |
| Molecular Formula | C13H12BrFIN3 |
| Molecular Weight | 436.07 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(F)cc(Br)c2)ncc1I |
| InChI | InChI=1S/C13H12BrFIN3/c1-2-3-17-13-11(16)7-18-12(19-13)8-4-9(14)6-10(15)5-8/h4-7H,2-3H2,1H3,(H,17,18,19) |
| InChIKey | CRAWRFXEVMGPJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.07 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|