C14H22BrN3S — CID 66299440
5-bromo-2-(cyclohexylsulfanylmethyl)-6-ethyl-N-methylpyrimidin-4-amine (PubChem CID 66299440) has the molecular formula C14H22BrN3S and a molecular weight of 344.32 g/mol. Its IUPAC name is 5-bromo-2-(cyclohexylsulfanylmethyl)-6-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(cyclohexylsulfanylmethyl)-6-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299440 |
| Molecular Formula | C14H22BrN3S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 5-bromo-2-(cyclohexylsulfanylmethyl)-6-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(CSC2CCCCC2)nc(NC)c1Br |
| InChI | InChI=1S/C14H22BrN3S/c1-3-11-13(15)14(16-2)18-12(17-11)9-19-10-7-5-4-6-8-10/h10H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | NEPZFKKHOMKDBM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |