C14H18IN3O — CID 66300943
2-(furan-3-yl)-5-iodo-6-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 66300943) has the molecular formula C14H18IN3O and a molecular weight of 371.22 g/mol. Its IUPAC name is 2-(furan-3-yl)-5-iodo-6-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(furan-3-yl)-5-iodo-6-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66300943 |
| Molecular Formula | C14H18IN3O |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-(furan-3-yl)-5-iodo-6-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2ccoc2)nc(C(C)C)c1I |
| InChI | InChI=1S/C14H18IN3O/c1-4-6-16-14-11(15)12(9(2)3)17-13(18-14)10-5-7-19-8-10/h5,7-9H,4,6H2,1-3H3,(H,16,17,18) |
| InChIKey | SAHWNKUHCOFOPW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|