C15H17BrIN3 — CID 66301068
2-(2-bromophenyl)-6-ethyl-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 66301068) has the molecular formula C15H17BrIN3 and a molecular weight of 446.13 g/mol. Its IUPAC name is 2-(2-bromophenyl)-6-ethyl-5-iodo-N-propylpyrimidin-4-amine.
| Compound Name | 2-(2-bromophenyl)-6-ethyl-5-iodo-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66301068 |
| Molecular Formula | C15H17BrIN3 |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 2-(2-bromophenyl)-6-ethyl-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2ccccc2Br)nc(CC)c1I |
| InChI | InChI=1S/C15H17BrIN3/c1-3-9-18-15-13(17)12(4-2)19-14(20-15)10-7-5-6-8-11(10)16/h5-8H,3-4,9H2,1-2H3,(H,18,19,20) |
| InChIKey | MYGQUJJEQJXJGB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|