C15H16IN3O — CID 66303839
2-(2,3-dihydro-1H-inden-1-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 66303839) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66303839 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(C2CCc3ccccc32)nc(N)c1I |
| InChI | InChI=1S/C15H16IN3O/c1-20-8-12-13(16)14(17)19-15(18-12)11-7-6-9-4-2-3-5-10(9)11/h2-5,11H,6-8H2,1H3,(H2,17,18,19) |
| InChIKey | KHIKJBXIGUMPNL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|