C14H15BrFN3S — CID 66305541
5-bromo-2-[(4-fluorophenyl)sulfanylmethyl]-6-propylpyrimidin-4-amine (PubChem CID 66305541) has the molecular formula C14H15BrFN3S and a molecular weight of 356.26 g/mol. Its IUPAC name is 5-bromo-2-[(4-fluorophenyl)sulfanylmethyl]-6-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-[(4-fluorophenyl)sulfanylmethyl]-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305541 |
| Molecular Formula | C14H15BrFN3S |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 5-bromo-2-[(4-fluorophenyl)sulfanylmethyl]-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(CSc2ccc(F)cc2)nc(N)c1Br |
| InChI | InChI=1S/C14H15BrFN3S/c1-2-3-11-13(15)14(17)19-12(18-11)8-20-10-6-4-9(16)5-7-10/h4-7H,2-3,8H2,1H3,(H2,17,18,19) |
| InChIKey | KKRZZDIKLIGNJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |