C14H15BrIN3S — CID 66307765
2-[(4-bromophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 66307765) has the molecular formula C14H15BrIN3S and a molecular weight of 464.17 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-[(4-bromophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307765 |
| Molecular Formula | C14H15BrIN3S |
| Molecular Weight | 464.17 g/mol |
| Exact Mass | 462.92 |
| IUPAC Name | 2-[(4-bromophenyl)sulfanylmethyl]-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(CSc2ccc(Br)cc2)nc(N)c1I |
| InChI | InChI=1S/C14H15BrIN3S/c1-2-3-11-13(16)14(17)19-12(18-11)8-20-10-6-4-9(15)5-7-10/h4-7H,2-3,8H2,1H3,(H2,17,18,19) |
| InChIKey | XGTFGHOZJZOWIC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.17 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|