C15H17Br2N3 — CID 66306418
5-bromo-2-(4-bromophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine (PubChem CID 66306418) has the molecular formula C15H17Br2N3 and a molecular weight of 399.13 g/mol. Its IUPAC name is 5-bromo-2-(4-bromophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-bromophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66306418 |
| Molecular Formula | C15H17Br2N3 |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 5-bromo-2-(4-bromophenyl)-6-tert-butyl-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(Br)cc2)nc(C(C)(C)C)c1Br |
| InChI | InChI=1S/C15H17Br2N3/c1-15(2,3)12-11(17)14(18-4)20-13(19-12)9-5-7-10(16)8-6-9/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | VJYRCFGJMYGQOO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |