C14H14ClIN2O3 — CID 66311459
4-chloro-5-iodo-6-methyl-2-(2,4,6-trimethoxyphenyl)pyrimidine (PubChem CID 66311459) has the molecular formula C14H14ClIN2O3 and a molecular weight of 420.63 g/mol. Its IUPAC name is 4-chloro-5-iodo-6-methyl-2-(2,4,6-trimethoxyphenyl)pyrimidine.
| Compound Name | 4-chloro-5-iodo-6-methyl-2-(2,4,6-trimethoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 66311459 |
| Molecular Formula | C14H14ClIN2O3 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 4-chloro-5-iodo-6-methyl-2-(2,4,6-trimethoxyphenyl)pyrimidine |
| SMILES | COc1cc(OC)c(-c2nc(C)c(I)c(Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C14H14ClIN2O3/c1-7-12(16)13(15)18-14(17-7)11-9(20-3)5-8(19-2)6-10(11)21-4/h5-6H,1-4H3 |
| InChIKey | LYKXDEWJDZBSNZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|