C14H14BrClN2 — CID 66313424
5-bromo-4-chloro-2-(2,5-dimethylphenyl)-6-ethylpyrimidine (PubChem CID 66313424) has the molecular formula C14H14BrClN2 and a molecular weight of 325.64 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-(2,5-dimethylphenyl)-6-ethylpyrimidine.
| Compound Name | 5-bromo-4-chloro-2-(2,5-dimethylphenyl)-6-ethylpyrimidine |
|---|---|
| PubChem CID | 66313424 |
| Molecular Formula | C14H14BrClN2 |
| Molecular Weight | 325.64 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-bromo-4-chloro-2-(2,5-dimethylphenyl)-6-ethylpyrimidine |
| SMILES | CCc1nc(-c2cc(C)ccc2C)nc(Cl)c1Br |
| InChI | InChI=1S/C14H14BrClN2/c1-4-11-12(15)13(16)18-14(17-11)10-7-8(2)5-6-9(10)3/h5-7H,4H2,1-3H3 |
| InChIKey | ZWTUCFNPFGXOLT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |