C15H16ClIN2 — CID 66313802
4-chloro-2-(2,5-dimethylphenyl)-5-iodo-6-propylpyrimidine (PubChem CID 66313802) has the molecular formula C15H16ClIN2 and a molecular weight of 386.66 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dimethylphenyl)-5-iodo-6-propylpyrimidine.
| Compound Name | 4-chloro-2-(2,5-dimethylphenyl)-5-iodo-6-propylpyrimidine |
|---|---|
| PubChem CID | 66313802 |
| Molecular Formula | C15H16ClIN2 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 4-chloro-2-(2,5-dimethylphenyl)-5-iodo-6-propylpyrimidine |
| SMILES | CCCc1nc(-c2cc(C)ccc2C)nc(Cl)c1I |
| InChI | InChI=1S/C15H16ClIN2/c1-4-5-12-13(17)14(16)19-15(18-12)11-8-9(2)6-7-10(11)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | JCTKTZLQPZRFOG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|