C8H9IN2O3 — CID 66314501
2-(1,4-dioxan-2-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 66314501) has the molecular formula C8H9IN2O3 and a molecular weight of 308.08 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(1,4-dioxan-2-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66314501 |
| Molecular Formula | C8H9IN2O3 |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2COCCO2)ncc1I |
| InChI | InChI=1S/C8H9IN2O3/c9-5-3-10-7(11-8(5)12)6-4-13-1-2-14-6/h3,6H,1-2,4H2,(H,10,11,12) |
| InChIKey | WWUKEUPYJWQWRG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|