C8H9IN2O4 — CID 66285780
2-(1,4-dioxan-2-yl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one (PubChem CID 66285780) has the molecular formula C8H9IN2O4 and a molecular weight of 324.07 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(1,4-dioxan-2-yl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66285780 |
| Molecular Formula | C8H9IN2O4 |
| Molecular Weight | 324.07 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2COCCO2)nc(O)c1I |
| InChI | InChI=1S/C8H9IN2O4/c9-5-7(12)10-6(11-8(5)13)4-3-14-1-2-15-4/h4H,1-3H2,(H2,10,11,12,13) |
| InChIKey | ATOKZKAVIIZGSF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.07 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|