C8H10N2O4 — CID 65351154
2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 65351154) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 65351154 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(C2COCCO2)[nH]1 |
| InChI | InChI=1S/C8H10N2O4/c11-6-3-7(12)10-8(9-6)5-4-13-1-2-14-5/h3,5H,1-2,4H2,(H2,9,10,11,12) |
| InChIKey | JTWXXEQCWLKQKU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |