C10H14N2O4 — CID 65351262
2-(1,4-dioxan-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 65351262) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(1,4-dioxan-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 65351262 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCc1c(O)nc(C2COCCO2)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-2-6-9(13)11-8(12-10(6)14)7-5-15-3-4-16-7/h7H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | MSVNCRNUUXQNLO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |