About N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine
N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine (PubChem CID 66317906) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 66317906 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine |
| SMILES | CCOc1cc(N(C)CCNC(C)(C)C)ncn1 |
| InChI | InChI=1S/C13H24N4O/c1-6-18-12-9-11(14-10-15-12)17(5)8-7-16-13(2,3)4/h9-10,16H,6-8H2,1-5H3 |
| InChIKey | AYMSLADSAQZABU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine (CID 66317906) is N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine is CCOc1cc(N(C)CCNC(C)(C)C)ncn1.
What is the InChIKey of N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine?
The InChIKey is AYMSLADSAQZABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-6-18-12-9-11(14-10-15-12)17(5)8-7-16-13(2,3)4/h9-10,16H,6-8H2,1-5H3.
What are the key properties of N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine?
N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine has a molecular weight of 252.36 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(6-ethoxypyrimidin-4-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 66317906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).