C12H12IN3S — CID 66318811
N-cyclopropyl-5-iodo-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 66318811) has the molecular formula C12H12IN3S and a molecular weight of 357.22 g/mol. Its IUPAC name is N-cyclopropyl-5-iodo-N-(thiophen-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-5-iodo-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66318811 |
| Molecular Formula | C12H12IN3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | N-cyclopropyl-5-iodo-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Ic1cncnc1N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C12H12IN3S/c13-11-6-14-8-15-12(11)16(9-3-4-9)7-10-2-1-5-17-10/h1-2,5-6,8-9H,3-4,7H2 |
| InChIKey | JCHXMNGGGSWPAZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|