C14H16ClN3S — CID 114215437
5-(chloromethyl)-N-cyclopropyl-2-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 114215437) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 5-(chloromethyl)-N-cyclopropyl-2-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 5-(chloromethyl)-N-cyclopropyl-2-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114215437 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-(chloromethyl)-N-cyclopropyl-2-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1ncc(CCl)c(N(Cc2cccs2)C2CC2)n1 |
| InChI | InChI=1S/C14H16ClN3S/c1-10-16-8-11(7-15)14(17-10)18(12-4-5-12)9-13-3-2-6-19-13/h2-3,6,8,12H,4-5,7,9H2,1H3 |
| InChIKey | HJBZSHXHECQGIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|