C15H15ClFNS — CID 114067735
2-(chloromethyl)-N-cyclopropyl-6-fluoro-N-(thiophen-2-ylmethyl)aniline (PubChem CID 114067735) has the molecular formula C15H15ClFNS and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(chloromethyl)-N-cyclopropyl-6-fluoro-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 2-(chloromethyl)-N-cyclopropyl-6-fluoro-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 114067735 |
| Molecular Formula | C15H15ClFNS |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(chloromethyl)-N-cyclopropyl-6-fluoro-N-(thiophen-2-ylmethyl)aniline |
| SMILES | Fc1cccc(CCl)c1N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C15H15ClFNS/c16-9-11-3-1-5-14(17)15(11)18(12-6-7-12)10-13-4-2-8-19-13/h1-5,8,12H,6-7,9-10H2 |
| InChIKey | LRYCZWHMOSZZKB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|