About N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine
N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine (PubChem CID 66318967) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine |
| PubChem CID | 66318967 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCCN)c1cc(OC)ncn1 |
| InChI | InChI=1S/C11H20N4O/c1-3-6-15(7-4-5-12)10-8-11(16-2)14-9-13-10/h8-9H,3-7,12H2,1-2H3 |
| InChIKey | LLNNFLAFWKWPSS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine?
The IUPAC name of N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine (CID 66318967) is N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine?
The canonical SMILES for N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine is CCCN(CCCN)c1cc(OC)ncn1.
What is the InChIKey of N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine?
The InChIKey is LLNNFLAFWKWPSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-3-6-15(7-4-5-12)10-8-11(16-2)14-9-13-10/h8-9H,3-7,12H2,1-2H3.
What are the key properties of N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine?
N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine has a molecular weight of 224.31 g/mol, XLogP of 1.05, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-methoxypyrimidin-4-yl)-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 66318967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).