C10H13N5O — CID 66320104
1-(6-methoxypyrimidin-4-yl)-3,5-dimethylpyrazol-4-amine (PubChem CID 66320104) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-(6-methoxypyrimidin-4-yl)-3,5-dimethylpyrazol-4-amine.
| Compound Name | 1-(6-methoxypyrimidin-4-yl)-3,5-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 66320104 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-(6-methoxypyrimidin-4-yl)-3,5-dimethylpyrazol-4-amine |
| SMILES | COc1cc(-n2nc(C)c(N)c2C)ncn1 |
| InChI | InChI=1S/C10H13N5O/c1-6-10(11)7(2)15(14-6)8-4-9(16-3)13-5-12-8/h4-5H,11H2,1-3H3 |
| InChIKey | CPHXYULXIBQUTJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |