C14H22N4O2 — CID 66325264
4-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]cyclohexane-1-carboxamide (PubChem CID 66325264) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66325264 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]cyclohexane-1-carboxamide |
| SMILES | CCOc1cc(NC2CCC(C(N)=O)CC2)nc(C)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-20-13-8-12(16-9(2)17-13)18-11-6-4-10(5-7-11)14(15)19/h8,10-11H,3-7H2,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | VMNYUGCVCZFWHM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |