C15H14FN5S — CID 663267
5-(4-fluorophenyl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 663267) has the molecular formula C15H14FN5S and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 5-(4-fluorophenyl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 663267 |
| Molecular Formula | C15H14FN5S |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-(4-fluorophenyl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nc2n(n1)C(c1cccs1)CC(c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C15H14FN5S/c16-10-5-3-9(4-6-10)11-8-12(13-2-1-7-22-13)21-15(18-11)19-14(17)20-21/h1-7,11-12H,8H2,(H3,17,18,19,20) |
| InChIKey | DQCJFQDDEQCKCN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |