C17H14Cl2FN5 — CID 135777687
(5R,7R)-7-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 135777687) has the molecular formula C17H14Cl2FN5 and a molecular weight of 378.24 g/mol. Its IUPAC name is (5R,7R)-7-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | (5R,7R)-7-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 135777687 |
| Molecular Formula | C17H14Cl2FN5 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (5R,7R)-7-(2,6-dichlorophenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nc2n(n1)[C@@H](c1c(Cl)cccc1Cl)C[C@H](c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C17H14Cl2FN5/c18-11-2-1-3-12(19)15(11)14-8-13(9-4-6-10(20)7-5-9)22-17-23-16(21)24-25(14)17/h1-7,13-14H,8H2,(H3,21,22,23,24)/t13-,14-/m1/s1 |
| InChIKey | DZXYYDMFBBWPNL-ZIAGYGMSSA-N |
| XLogP | 4.45 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |