C19H19ClFN5 — CID 135682859
(5R,7S)-7-(2-chloro-6-fluorophenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 135682859) has the molecular formula C19H19ClFN5 and a molecular weight of 371.85 g/mol. Its IUPAC name is (5R,7S)-7-(2-chloro-6-fluorophenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | (5R,7S)-7-(2-chloro-6-fluorophenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 135682859 |
| Molecular Formula | C19H19ClFN5 |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (5R,7S)-7-(2-chloro-6-fluorophenyl)-5-(4-ethylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CCc1ccc([C@H]2C[C@@H](c3c(F)cccc3Cl)n3nc(N)nc3N2)cc1 |
| InChI | InChI=1S/C19H19ClFN5/c1-2-11-6-8-12(9-7-11)15-10-16(17-13(20)4-3-5-14(17)21)26-19(23-15)24-18(22)25-26/h3-9,15-16H,2,10H2,1H3,(H3,22,23,24,25)/t15-,16+/m1/s1 |
| InChIKey | ZMZSDUXQWHFEHW-CVEARBPZSA-N |
| XLogP | 4.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |