C9H14N4O2 — CID 66327427
N-ethyl-2-[(6-methoxypyrimidin-4-yl)amino]acetamide (PubChem CID 66327427) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-ethyl-2-[(6-methoxypyrimidin-4-yl)amino]acetamide.
| Compound Name | N-ethyl-2-[(6-methoxypyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 66327427 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-ethyl-2-[(6-methoxypyrimidin-4-yl)amino]acetamide |
| SMILES | CCNC(=O)CNc1cc(OC)ncn1 |
| InChI | InChI=1S/C9H14N4O2/c1-3-10-8(14)5-11-7-4-9(15-2)13-6-12-7/h4,6H,3,5H2,1-2H3,(H,10,14)(H,11,12,13) |
| InChIKey | KDTQMIRCLUNQLS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |