C9H13N3O3 — CID 66318731
2-[(6-methoxypyrimidin-4-yl)amino]butanoic acid (PubChem CID 66318731) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-[(6-methoxypyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 2-[(6-methoxypyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 66318731 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(6-methoxypyrimidin-4-yl)amino]butanoic acid |
| SMILES | CCC(Nc1cc(OC)ncn1)C(=O)O |
| InChI | InChI=1S/C9H13N3O3/c1-3-6(9(13)14)12-7-4-8(15-2)11-5-10-7/h4-6H,3H2,1-2H3,(H,13,14)(H,10,11,12) |
| InChIKey | JMDRNAWFTHAULS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |