C12H20N4O2 — CID 113407899
N-tert-butyl-2-[(6-methoxypyrimidin-4-yl)amino]propanamide (PubChem CID 113407899) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-tert-butyl-2-[(6-methoxypyrimidin-4-yl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(6-methoxypyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 113407899 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-tert-butyl-2-[(6-methoxypyrimidin-4-yl)amino]propanamide |
| SMILES | COc1cc(NC(C)C(=O)NC(C)(C)C)ncn1 |
| InChI | InChI=1S/C12H20N4O2/c1-8(11(17)16-12(2,3)4)15-9-6-10(18-5)14-7-13-9/h6-8H,1-5H3,(H,16,17)(H,13,14,15) |
| InChIKey | UKPORYCEINBSQL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |