C13H22N4O — CID 112690921
N-tert-butyl-2-[(2,6-dimethylpyrimidin-4-yl)amino]propanamide (PubChem CID 112690921) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N-tert-butyl-2-[(2,6-dimethylpyrimidin-4-yl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(2,6-dimethylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 112690921 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-tert-butyl-2-[(2,6-dimethylpyrimidin-4-yl)amino]propanamide |
| SMILES | Cc1cc(NC(C)C(=O)NC(C)(C)C)nc(C)n1 |
| InChI | InChI=1S/C13H22N4O/c1-8-7-11(16-10(3)14-8)15-9(2)12(18)17-13(4,5)6/h7,9H,1-6H3,(H,17,18)(H,14,15,16) |
| InChIKey | IEWSTWTYMGBMOF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |