About N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide
N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide (PubChem CID 86868244) has the molecular formula C17H29N5O
and a molecular weight of 319.45 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide |
| PubChem CID | 86868244 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide |
| SMILES | Cc1cc(N2CCN(C(C)C(=O)NC(C)(C)C)CC2)nc(C)n1 |
| InChI | InChI=1S/C17H29N5O/c1-12-11-15(19-14(3)18-12)22-9-7-21(8-10-22)13(2)16(23)20-17(4,5)6/h11,13H,7-10H2,1-6H3,(H,20,23) |
| InChIKey | AZCVPLWWACXRKL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide?
The IUPAC name of N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide (CID 86868244) is N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide.
What is the SMILES notation for N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide?
The canonical SMILES for N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide is Cc1cc(N2CCN(C(C)C(=O)NC(C)(C)C)CC2)nc(C)n1.
What is the InChIKey of N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide?
The InChIKey is AZCVPLWWACXRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N5O/c1-12-11-15(19-14(3)18-12)22-9-7-21(8-10-22)13(2)16(23)20-17(4,5)6/h11,13H,7-10H2,1-6H3,(H,20,23).
What are the key properties of N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide?
N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide has a molecular weight of 319.45 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]propanamide is sourced from PubChem (CID 86868244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).