C13H21BrN2O — CID 66331791
4-(2-bromo-3,3-dimethylbutyl)-6-propoxypyrimidine (PubChem CID 66331791) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-(2-bromo-3,3-dimethylbutyl)-6-propoxypyrimidine.
| Compound Name | 4-(2-bromo-3,3-dimethylbutyl)-6-propoxypyrimidine |
|---|---|
| PubChem CID | 66331791 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-(2-bromo-3,3-dimethylbutyl)-6-propoxypyrimidine |
| SMILES | CCCOc1cc(CC(Br)C(C)(C)C)ncn1 |
| InChI | InChI=1S/C13H21BrN2O/c1-5-6-17-12-8-10(15-9-16-12)7-11(14)13(2,3)4/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | WRQWBAIRMUVEKP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|