C13H23N3O — CID 66334016
3,3-dimethyl-1-(6-propoxypyrimidin-4-yl)butan-2-amine (PubChem CID 66334016) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-(6-propoxypyrimidin-4-yl)butan-2-amine.
| Compound Name | 3,3-dimethyl-1-(6-propoxypyrimidin-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 66334016 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3,3-dimethyl-1-(6-propoxypyrimidin-4-yl)butan-2-amine |
| SMILES | CCCOc1cc(CC(N)C(C)(C)C)ncn1 |
| InChI | InChI=1S/C13H23N3O/c1-5-6-17-12-8-10(15-9-16-12)7-11(14)13(2,3)4/h8-9,11H,5-7,14H2,1-4H3 |
| InChIKey | XMMHCBDTZSIIGX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |