C12H16N2O3 — CID 66337101
hydrazinyl 3-(2,3-dihydro-1H-inden-5-yloxy)propanoate (PubChem CID 66337101) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is hydrazinyl 3-(2,3-dihydro-1H-inden-5-yloxy)propanoate.
| Compound Name | hydrazinyl 3-(2,3-dihydro-1H-inden-5-yloxy)propanoate |
|---|---|
| PubChem CID | 66337101 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | hydrazinyl 3-(2,3-dihydro-1H-inden-5-yloxy)propanoate |
| SMILES | NNOC(=O)CCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H16N2O3/c13-14-17-12(15)6-7-16-11-5-4-9-2-1-3-10(9)8-11/h4-5,8,14H,1-3,6-7,13H2 |
| InChIKey | UXADJWGYCHUOGK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|