C12H15N3O4 — CID 114939971
hydrazinyl 3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]propanoate (PubChem CID 114939971) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is hydrazinyl 3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]propanoate.
| Compound Name | hydrazinyl 3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]propanoate |
|---|---|
| PubChem CID | 114939971 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | hydrazinyl 3-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]propanoate |
| SMILES | NNOC(=O)CCOc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C12H15N3O4/c13-15-19-12(17)5-6-18-9-3-1-8-2-4-11(16)14-10(8)7-9/h1,3,7,15H,2,4-6,13H2,(H,14,16) |
| InChIKey | KJKSOGLJNJXLTN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|