C11H21N3O3 — CID 66339147
hydrazinyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propanoate (PubChem CID 66339147) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is hydrazinyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propanoate.
| Compound Name | hydrazinyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 66339147 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | hydrazinyl 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propanoate |
| SMILES | NNOC(=O)CCN1CCOC2CCCCC21 |
| InChI | InChI=1S/C11H21N3O3/c12-13-17-11(15)5-6-14-7-8-16-10-4-2-1-3-9(10)14/h9-10,13H,1-8,12H2 |
| InChIKey | OFGJLDVBIPZFTK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|