C14H24N2O4 — CID 100906324
methyl 2-[3-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]propanoylamino]acetate (PubChem CID 100906324) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl 2-[3-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]propanoylamino]acetate.
| Compound Name | methyl 2-[3-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 100906324 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | methyl 2-[3-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]propanoylamino]acetate |
| SMILES | COC(=O)CNC(=O)CCN1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H24N2O4/c1-19-14(18)10-15-13(17)6-7-16-8-9-20-12-5-3-2-4-11(12)16/h11-12H,2-10H2,1H3,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | LUHLDCGYGQPPIW-VXGBXAGGSA-N |
| XLogP | 0.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |