C16H20Cl2N2O2 — CID 96549635
3-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N-(2,6-dichlorophenyl)propanamide (PubChem CID 96549635) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 3-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N-(2,6-dichlorophenyl)propanamide.
| Compound Name | 3-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 96549635 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-N-(2,6-dichlorophenyl)propanamide |
| SMILES | O=C(CCN1CCO[C@H]2CCC[C@@H]21)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O2/c17-11-3-1-4-12(18)16(11)19-15(21)7-8-20-9-10-22-14-6-2-5-13(14)20/h1,3-4,13-14H,2,5-10H2,(H,19,21)/t13-,14-/m0/s1 |
| InChIKey | QBNJXXSBQIQISL-KBPBESRZSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |