C11H18N4O2 — CID 66339679
hydrazinyl 3-[methyl(2-pyridin-4-ylethyl)amino]propanoate (PubChem CID 66339679) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is hydrazinyl 3-[methyl(2-pyridin-4-ylethyl)amino]propanoate.
| Compound Name | hydrazinyl 3-[methyl(2-pyridin-4-ylethyl)amino]propanoate |
|---|---|
| PubChem CID | 66339679 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | hydrazinyl 3-[methyl(2-pyridin-4-ylethyl)amino]propanoate |
| SMILES | CN(CCC(=O)ONN)CCc1ccncc1 |
| InChI | InChI=1S/C11H18N4O2/c1-15(9-5-11(16)17-14-12)8-4-10-2-6-13-7-3-10/h2-3,6-7,14H,4-5,8-9,12H2,1H3 |
| InChIKey | BSHDUIRXDFAAFS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|