C11H17IN2O3 — CID 66340012
3-(2,2-diethoxyethyl)-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66340012) has the molecular formula C11H17IN2O3 and a molecular weight of 352.17 g/mol. Its IUPAC name is 3-(2,2-diethoxyethyl)-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-(2,2-diethoxyethyl)-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66340012 |
| Molecular Formula | C11H17IN2O3 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-(2,2-diethoxyethyl)-5-iodo-6-methylpyrimidin-4-one |
| SMILES | CCOC(Cn1cnc(C)c(I)c1=O)OCC |
| InChI | InChI=1S/C11H17IN2O3/c1-4-16-9(17-5-2)6-14-7-13-8(3)10(12)11(14)15/h7,9H,4-6H2,1-3H3 |
| InChIKey | MDEPIQTWVTYERS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|