C8H11IN2O3 — CID 82850471
3-(2,3-dihydroxypropyl)-5-iodo-6-methylpyrimidin-4-one (PubChem CID 82850471) has the molecular formula C8H11IN2O3 and a molecular weight of 310.09 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-(2,3-dihydroxypropyl)-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 82850471 |
| Molecular Formula | C8H11IN2O3 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(CC(O)CO)c(=O)c1I |
| InChI | InChI=1S/C8H11IN2O3/c1-5-7(9)8(14)11(4-10-5)2-6(13)3-12/h4,6,12-13H,2-3H2,1H3 |
| InChIKey | JQQBTBUQESFYAV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|